C23H21N3S — CID 5466909
(9E)-9-benzylidene-5-phenyl-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazolin-3-imine (PubChem CID 5466909) has the molecular formula C23H21N3S and a molecular weight of 371.51 g/mol. Its IUPAC name is (9E)-9-benzylidene-5-phenyl-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazolin-3-imine.
| Compound Name | (9E)-9-benzylidene-5-phenyl-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazolin-3-imine |
|---|---|
| PubChem CID | 5466909 |
| Molecular Formula | C23H21N3S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | (9E)-9-benzylidene-5-phenyl-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazolin-3-imine |
| SMILES | [H]/N=C1\CSC2=NC3=C(CCC/C3=C\c3ccccc3)C(c3ccccc3)N21 |
| InChI | InChI=1S/C23H21N3S/c24-20-15-27-23-25-21-18(14-16-8-3-1-4-9-16)12-7-13-19(21)22(26(20)23)17-10-5-2-6-11-17/h1-6,8-11,14,22,24H,7,12-13,15H2/b18-14+,24-20+ |
| InChIKey | ZFMXFZRSVPPFHE-PSHOMLQGSA-N |
| XLogP | 5.64 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|