C40H41N3O5 — CID 54669705
2-[4-[[2,3-dimethyl-5-[[(1S)-1-(1-phenylmethoxycarbonylpiperidin-4-yl)ethyl]carbamoyl]indol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 54669705) has the molecular formula C40H41N3O5 and a molecular weight of 643.78 g/mol. Its IUPAC name is 2-[4-[[2,3-dimethyl-5-[[(1S)-1-(1-phenylmethoxycarbonylpiperidin-4-yl)ethyl]carbamoyl]indol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[2,3-dimethyl-5-[[(1S)-1-(1-phenylmethoxycarbonylpiperidin-4-yl)ethyl]carbamoyl]indol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 54669705 |
| Molecular Formula | C40H41N3O5 |
| Molecular Weight | 643.78 g/mol |
| Exact Mass | 643.30 |
| IUPAC Name | 2-[4-[[2,3-dimethyl-5-[[(1S)-1-(1-phenylmethoxycarbonylpiperidin-4-yl)ethyl]carbamoyl]indol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3C(=O)O)cc2)c2ccc(C(=O)N[C@@H](C)C3CCN(C(=O)OCc4ccccc4)CC3)cc12 |
| InChI | InChI=1S/C40H41N3O5/c1-26-28(3)43(24-29-13-15-32(16-14-29)34-11-7-8-12-35(34)39(45)46)37-18-17-33(23-36(26)37)38(44)41-27(2)31-19-21-42(22-20-31)40(47)48-25-30-9-5-4-6-10-30/h4-18,23,27,31H,19-22,24-25H2,1-3H3,(H,41,44)(H,45,46)/t27-/m0/s1 |
| InChIKey | DZODKUVBVKEFGB-MHZLTWQESA-N |
| XLogP | 7.84 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.78 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|