About N-methyl-1-methylsulfanyl-1-phenylmethanimine oxide;hydroiodide
N-methyl-1-methylsulfanyl-1-phenylmethanimine oxide;hydroiodide (PubChem CID 5466974) has the molecular formula C9H12INOS
and a molecular weight of 309.17 g/mol. Its IUPAC name is N-methyl-1-methylsulfanyl-1-phenylmethanimine oxide;hydroiodide.
Molecular Properties
| Compound Name | N-methyl-1-methylsulfanyl-1-phenylmethanimine oxide;hydroiodide |
| PubChem CID | 5466974 |
| Molecular Formula | C9H12INOS |
| Molecular Weight | 309.17 g/mol |
| Exact Mass | 308.97 |
| IUPAC Name | N-methyl-1-methylsulfanyl-1-phenylmethanimine oxide;hydroiodide |
| SMILES | CS/C(c1ccccc1)=[N+](/C)[O-].I |
| InChI | InChI=1S/C9H11NOS.HI/c1-10(11)9(12-2)8-6-4-3-5-7-8;/h3-7H,1-2H3;1H/b10-9-; |
| InChIKey | FXGDTQFBQPKEKR-KVVVOXFISA-N |
| XLogP | 2.55 |
| TPSA | 26.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.17 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-1-methylsulfanyl-1-phenylmethanimine oxide;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-methylsulfanyl-1-phenylmethanimine oxide;hydroiodide?
The IUPAC name of N-methyl-1-methylsulfanyl-1-phenylmethanimine oxide;hydroiodide (CID 5466974) is N-methyl-1-methylsulfanyl-1-phenylmethanimine oxide;hydroiodide.
What is the SMILES notation for N-methyl-1-methylsulfanyl-1-phenylmethanimine oxide;hydroiodide?
The canonical SMILES for N-methyl-1-methylsulfanyl-1-phenylmethanimine oxide;hydroiodide is CS/C(c1ccccc1)=[N+](/C)[O-].I.
What is the InChIKey of N-methyl-1-methylsulfanyl-1-phenylmethanimine oxide;hydroiodide?
The InChIKey is FXGDTQFBQPKEKR-KVVVOXFISA-N. The full InChI is InChI=1S/C9H11NOS.HI/c1-10(11)9(12-2)8-6-4-3-5-7-8;/h3-7H,1-2H3;1H/b10-9-;.
What are the key properties of N-methyl-1-methylsulfanyl-1-phenylmethanimine oxide;hydroiodide?
N-methyl-1-methylsulfanyl-1-phenylmethanimine oxide;hydroiodide has a molecular weight of 309.17 g/mol, XLogP of 2.55, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-methylsulfanyl-1-phenylmethanimine oxide;hydroiodide is sourced from PubChem (CID 5466974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).