C17H26N2O2 — CID 54669846
(2E)-6-[(6-ethyl-2-pyridinyl)-hydroxyamino]-3,7-dimethylocta-2,7-dien-1-ol (PubChem CID 54669846) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is (2E)-6-[(6-ethyl-2-pyridinyl)-hydroxyamino]-3,7-dimethylocta-2,7-dien-1-ol.
| Compound Name | (2E)-6-[(6-ethyl-2-pyridinyl)-hydroxyamino]-3,7-dimethylocta-2,7-dien-1-ol |
|---|---|
| PubChem CID | 54669846 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | (2E)-6-[(6-ethyl-2-pyridinyl)-hydroxyamino]-3,7-dimethylocta-2,7-dien-1-ol |
| SMILES | C=C(C)C(CC/C(C)=C/CO)N(O)c1cccc(CC)n1 |
| InChI | InChI=1S/C17H26N2O2/c1-5-15-7-6-8-17(18-15)19(21)16(13(2)3)10-9-14(4)11-12-20/h6-8,11,16,20-21H,2,5,9-10,12H2,1,3-4H3/b14-11+ |
| InChIKey | ZKTFIFQABFZEQZ-SDNWHVSQSA-N |
| XLogP | 3.50 |
| TPSA | 56.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|