C23H27FN6O2 — CID 54670446
(6R)-N-ethyl-9-fluoro-13-oxa-2,17,21,22,25-pentazapentacyclo[17.5.2.02,6.07,12.022,26]hexacosa-1(25),7(12),8,10,19(26),20,23-heptaene-17-carboxamide (PubChem CID 54670446) has the molecular formula C23H27FN6O2 and a molecular weight of 438.51 g/mol. Its IUPAC name is (6R)-N-ethyl-9-fluoro-13-oxa-2,17,21,22,25-pentazapentacyclo[17.5.2.02,6.07,12.022,26]hexacosa-1(25),7(12),8,10,19(26),20,23-heptaene-17-carboxamide.
| Compound Name | (6R)-N-ethyl-9-fluoro-13-oxa-2,17,21,22,25-pentazapentacyclo[17.5.2.02,6.07,12.022,26]hexacosa-1(25),7(12),8,10,19(26),20,23-heptaene-17-carboxamide |
|---|---|
| PubChem CID | 54670446 |
| Molecular Formula | C23H27FN6O2 |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | (6R)-N-ethyl-9-fluoro-13-oxa-2,17,21,22,25-pentazapentacyclo[17.5.2.02,6.07,12.022,26]hexacosa-1(25),7(12),8,10,19(26),20,23-heptaene-17-carboxamide |
| SMILES | CCNC(=O)N1CCCOc2ccc(F)cc2[C@H]2CCCN2c2ccn3ncc(c3n2)C1 |
| InChI | InChI=1S/C23H27FN6O2/c1-2-25-23(31)28-9-4-12-32-20-7-6-17(24)13-18(20)19-5-3-10-29(19)21-8-11-30-22(27-21)16(15-28)14-26-30/h6-8,11,13-14,19H,2-5,9-10,12,15H2,1H3,(H,25,31)/t19-/m1/s1 |
| InChIKey | KTIPIUBAJJNKRV-LJQANCHMSA-N |
| XLogP | 3.52 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |