About 2-[2-[(4-methyl-1,3-thiazol-5-yl)-phenylmethoxy]ethoxy]ethyl nitrate
2-[2-[(4-methyl-1,3-thiazol-5-yl)-phenylmethoxy]ethoxy]ethyl nitrate (PubChem CID 54670642) has the molecular formula C15H18N2O5S
and a molecular weight of 338.39 g/mol. Its IUPAC name is 2-[2-[(4-methyl-1,3-thiazol-5-yl)-phenylmethoxy]ethoxy]ethyl nitrate.
Molecular Properties
| Compound Name | 2-[2-[(4-methyl-1,3-thiazol-5-yl)-phenylmethoxy]ethoxy]ethyl nitrate |
| PubChem CID | 54670642 |
| Molecular Formula | C15H18N2O5S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 2-[2-[(4-methyl-1,3-thiazol-5-yl)-phenylmethoxy]ethoxy]ethyl nitrate |
| SMILES | Cc1ncsc1C(OCCOCCO[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C15H18N2O5S/c1-12-15(23-11-16-12)14(13-5-3-2-4-6-13)21-9-7-20-8-10-22-17(18)19/h2-6,11,14H,7-10H2,1H3 |
| InChIKey | BLAGLQYLHPMIMQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(4-methyl-1,3-thiazol-5-yl)-phenylmethoxy]ethoxy]ethyl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(4-methyl-1,3-thiazol-5-yl)-phenylmethoxy]ethoxy]ethyl nitrate?
The IUPAC name of 2-[2-[(4-methyl-1,3-thiazol-5-yl)-phenylmethoxy]ethoxy]ethyl nitrate (CID 54670642) is 2-[2-[(4-methyl-1,3-thiazol-5-yl)-phenylmethoxy]ethoxy]ethyl nitrate.
What is the SMILES notation for 2-[2-[(4-methyl-1,3-thiazol-5-yl)-phenylmethoxy]ethoxy]ethyl nitrate?
The canonical SMILES for 2-[2-[(4-methyl-1,3-thiazol-5-yl)-phenylmethoxy]ethoxy]ethyl nitrate is Cc1ncsc1C(OCCOCCO[N+](=O)[O-])c1ccccc1.
What is the InChIKey of 2-[2-[(4-methyl-1,3-thiazol-5-yl)-phenylmethoxy]ethoxy]ethyl nitrate?
The InChIKey is BLAGLQYLHPMIMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O5S/c1-12-15(23-11-16-12)14(13-5-3-2-4-6-13)21-9-7-20-8-10-22-17(18)19/h2-6,11,14H,7-10H2,1H3.
What are the key properties of 2-[2-[(4-methyl-1,3-thiazol-5-yl)-phenylmethoxy]ethoxy]ethyl nitrate?
2-[2-[(4-methyl-1,3-thiazol-5-yl)-phenylmethoxy]ethoxy]ethyl nitrate has a molecular weight of 338.39 g/mol, XLogP of 2.78, 10 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(4-methyl-1,3-thiazol-5-yl)-phenylmethoxy]ethoxy]ethyl nitrate is sourced from PubChem (CID 54670642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).