About N-[2-(2,5-difluorophenyl)-4-pyridinyl]-1H-pyrazolo[4,3-b]pyridin-7-amine
N-[2-(2,5-difluorophenyl)-4-pyridinyl]-1H-pyrazolo[4,3-b]pyridin-7-amine (PubChem CID 54670693) has the molecular formula C17H11F2N5
and a molecular weight of 323.31 g/mol. Its IUPAC name is N-[2-(2,5-difluorophenyl)-4-pyridinyl]-1H-pyrazolo[4,3-b]pyridin-7-amine.
Molecular Properties
| Compound Name | N-[2-(2,5-difluorophenyl)-4-pyridinyl]-1H-pyrazolo[4,3-b]pyridin-7-amine |
| PubChem CID | 54670693 |
| Molecular Formula | C17H11F2N5 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | N-[2-(2,5-difluorophenyl)-4-pyridinyl]-1H-pyrazolo[4,3-b]pyridin-7-amine |
| SMILES | Fc1ccc(F)c(-c2cc(Nc3ccnc4cn[nH]c34)ccn2)c1 |
| InChI | InChI=1S/C17H11F2N5/c18-10-1-2-13(19)12(7-10)15-8-11(3-5-20-15)23-14-4-6-21-16-9-22-24-17(14)16/h1-9H,(H,22,24)(H,20,21,23) |
| InChIKey | DUNSTQZKFKHIIG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(2,5-difluorophenyl)-4-pyridinyl]-1H-pyrazolo[4,3-b]pyridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,5-difluorophenyl)-4-pyridinyl]-1H-pyrazolo[4,3-b]pyridin-7-amine?
The IUPAC name of N-[2-(2,5-difluorophenyl)-4-pyridinyl]-1H-pyrazolo[4,3-b]pyridin-7-amine (CID 54670693) is N-[2-(2,5-difluorophenyl)-4-pyridinyl]-1H-pyrazolo[4,3-b]pyridin-7-amine.
What is the SMILES notation for N-[2-(2,5-difluorophenyl)-4-pyridinyl]-1H-pyrazolo[4,3-b]pyridin-7-amine?
The canonical SMILES for N-[2-(2,5-difluorophenyl)-4-pyridinyl]-1H-pyrazolo[4,3-b]pyridin-7-amine is Fc1ccc(F)c(-c2cc(Nc3ccnc4cn[nH]c34)ccn2)c1.
What is the InChIKey of N-[2-(2,5-difluorophenyl)-4-pyridinyl]-1H-pyrazolo[4,3-b]pyridin-7-amine?
The InChIKey is DUNSTQZKFKHIIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11F2N5/c18-10-1-2-13(19)12(7-10)15-8-11(3-5-20-15)23-14-4-6-21-16-9-22-24-17(14)16/h1-9H,(H,22,24)(H,20,21,23).
What are the key properties of N-[2-(2,5-difluorophenyl)-4-pyridinyl]-1H-pyrazolo[4,3-b]pyridin-7-amine?
N-[2-(2,5-difluorophenyl)-4-pyridinyl]-1H-pyrazolo[4,3-b]pyridin-7-amine has a molecular weight of 323.31 g/mol, XLogP of 4.04, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,5-difluorophenyl)-4-pyridinyl]-1H-pyrazolo[4,3-b]pyridin-7-amine is sourced from PubChem (CID 54670693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).