C13H15ClF3N3O3 — CID 546712
ethyl 2-[(2-chloro-3-pyridinyl)amino]-3,3,3-trifluoro-2-(propanoylamino)propanoate (PubChem CID 546712) has the molecular formula C13H15ClF3N3O3 and a molecular weight of 353.73 g/mol. Its IUPAC name is ethyl 2-[(2-chloro-3-pyridinyl)amino]-3,3,3-trifluoro-2-(propanoylamino)propanoate.
| Compound Name | ethyl 2-[(2-chloro-3-pyridinyl)amino]-3,3,3-trifluoro-2-(propanoylamino)propanoate |
|---|---|
| PubChem CID | 546712 |
| Molecular Formula | C13H15ClF3N3O3 |
| Molecular Weight | 353.73 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | ethyl 2-[(2-chloro-3-pyridinyl)amino]-3,3,3-trifluoro-2-(propanoylamino)propanoate |
| SMILES | CCOC(=O)C(NC(=O)CC)(Nc1cccnc1Cl)C(F)(F)F |
| InChI | InChI=1S/C13H15ClF3N3O3/c1-3-9(21)20-12(13(15,16)17,11(22)23-4-2)19-8-6-5-7-18-10(8)14/h5-7,19H,3-4H2,1-2H3,(H,20,21) |
| InChIKey | HOQZYFZFIPPABI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.73 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|