C15H20F3NO3S — CID 54671224
methyl (3R)-3-[[(S)-tert-butylsulfinyl]amino]-4-(2,4,5-trifluorophenyl)butanoate (PubChem CID 54671224) has the molecular formula C15H20F3NO3S and a molecular weight of 351.39 g/mol. Its IUPAC name is methyl (3R)-3-[[(S)-tert-butylsulfinyl]amino]-4-(2,4,5-trifluorophenyl)butanoate.
| Compound Name | methyl (3R)-3-[[(S)-tert-butylsulfinyl]amino]-4-(2,4,5-trifluorophenyl)butanoate |
|---|---|
| PubChem CID | 54671224 |
| Molecular Formula | C15H20F3NO3S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | methyl (3R)-3-[[(S)-tert-butylsulfinyl]amino]-4-(2,4,5-trifluorophenyl)butanoate |
| SMILES | COC(=O)C[C@@H](Cc1cc(F)c(F)cc1F)N[S@@](=O)C(C)(C)C |
| InChI | InChI=1S/C15H20F3NO3S/c1-15(2,3)23(21)19-10(7-14(20)22-4)5-9-6-12(17)13(18)8-11(9)16/h6,8,10,19H,5,7H2,1-4H3/t10-,23+/m1/s1 |
| InChIKey | QSXHXRSVFVEOBW-WYVULQQZSA-N |
| XLogP | 2.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|