C23H37BClNO2Si — CID 54671452
[5-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]-tri(propan-2-yl)silane (PubChem CID 54671452) has the molecular formula C23H37BClNO2Si and a molecular weight of 433.91 g/mol. Its IUPAC name is [5-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]-tri(propan-2-yl)silane.
| Compound Name | [5-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 54671452 |
| Molecular Formula | C23H37BClNO2Si |
| Molecular Weight | 433.91 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | [5-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)n1cc(B2OC(C)(C)C(C)(C)O2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C23H37BClNO2Si/c1-15(2)29(16(3)4,17(5)6)26-14-20(19-13-18(25)11-12-21(19)26)24-27-22(7,8)23(9,10)28-24/h11-17H,1-10H3 |
| InChIKey | ASACENASMVBJRN-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.91 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|