C17H28O8 — CID 54671504
dimethyl (2R,3R,4S)-4-hydroxy-3-(methoxymethoxy)-3-methyl-2-pentyl-2,4-dihydropyran-5,6-dicarboxylate (PubChem CID 54671504) has the molecular formula C17H28O8 and a molecular weight of 360.40 g/mol. Its IUPAC name is dimethyl (2R,3R,4S)-4-hydroxy-3-(methoxymethoxy)-3-methyl-2-pentyl-2,4-dihydropyran-5,6-dicarboxylate.
| Compound Name | dimethyl (2R,3R,4S)-4-hydroxy-3-(methoxymethoxy)-3-methyl-2-pentyl-2,4-dihydropyran-5,6-dicarboxylate |
|---|---|
| PubChem CID | 54671504 |
| Molecular Formula | C17H28O8 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | dimethyl (2R,3R,4S)-4-hydroxy-3-(methoxymethoxy)-3-methyl-2-pentyl-2,4-dihydropyran-5,6-dicarboxylate |
| SMILES | CCCCC[C@H]1OC(C(=O)OC)=C(C(=O)OC)[C@H](O)[C@@]1(C)OCOC |
| InChI | InChI=1S/C17H28O8/c1-6-7-8-9-11-17(2,24-10-21-3)14(18)12(15(19)22-4)13(25-11)16(20)23-5/h11,14,18H,6-10H2,1-5H3/t11-,14+,17+/m1/s1 |
| InChIKey | IPDQKYFNCQHINQ-WHCBVINPSA-N |
| XLogP | 1.31 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|