About 1-(4-methylphenyl)sulfonyl-5,5-diphenylazepan-4-one
1-(4-methylphenyl)sulfonyl-5,5-diphenylazepan-4-one (PubChem CID 54671601) has the molecular formula C25H25NO3S
and a molecular weight of 419.55 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-5,5-diphenylazepan-4-one.
Molecular Properties
| Compound Name | 1-(4-methylphenyl)sulfonyl-5,5-diphenylazepan-4-one |
| PubChem CID | 54671601 |
| Molecular Formula | C25H25NO3S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-5,5-diphenylazepan-4-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(=O)C(c3ccccc3)(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C25H25NO3S/c1-20-12-14-23(15-13-20)30(28,29)26-18-16-24(27)25(17-19-26,21-8-4-2-5-9-21)22-10-6-3-7-11-22/h2-15H,16-19H2,1H3 |
| InChIKey | UVOIIFSPUUSKOE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-methylphenyl)sulfonyl-5,5-diphenylazepan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methylphenyl)sulfonyl-5,5-diphenylazepan-4-one?
The IUPAC name of 1-(4-methylphenyl)sulfonyl-5,5-diphenylazepan-4-one (CID 54671601) is 1-(4-methylphenyl)sulfonyl-5,5-diphenylazepan-4-one.
What is the SMILES notation for 1-(4-methylphenyl)sulfonyl-5,5-diphenylazepan-4-one?
The canonical SMILES for 1-(4-methylphenyl)sulfonyl-5,5-diphenylazepan-4-one is Cc1ccc(S(=O)(=O)N2CCC(=O)C(c3ccccc3)(c3ccccc3)CC2)cc1.
What is the InChIKey of 1-(4-methylphenyl)sulfonyl-5,5-diphenylazepan-4-one?
The InChIKey is UVOIIFSPUUSKOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25NO3S/c1-20-12-14-23(15-13-20)30(28,29)26-18-16-24(27)25(17-19-26,21-8-4-2-5-9-21)22-10-6-3-7-11-22/h2-15H,16-19H2,1H3.
What are the key properties of 1-(4-methylphenyl)sulfonyl-5,5-diphenylazepan-4-one?
1-(4-methylphenyl)sulfonyl-5,5-diphenylazepan-4-one has a molecular weight of 419.55 g/mol, XLogP of 4.33, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methylphenyl)sulfonyl-5,5-diphenylazepan-4-one is sourced from PubChem (CID 54671601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).