About [1-(4-methylphenyl)sulfonyl-5,5-diphenylazepan-4-yl] methanesulfonate
[1-(4-methylphenyl)sulfonyl-5,5-diphenylazepan-4-yl] methanesulfonate (PubChem CID 54671603) has the molecular formula C26H29NO5S2
and a molecular weight of 499.65 g/mol. Its IUPAC name is [1-(4-methylphenyl)sulfonyl-5,5-diphenylazepan-4-yl] methanesulfonate.
Molecular Properties
| Compound Name | [1-(4-methylphenyl)sulfonyl-5,5-diphenylazepan-4-yl] methanesulfonate |
| PubChem CID | 54671603 |
| Molecular Formula | C26H29NO5S2 |
| Molecular Weight | 499.65 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | [1-(4-methylphenyl)sulfonyl-5,5-diphenylazepan-4-yl] methanesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(OS(C)(=O)=O)C(c3ccccc3)(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H29NO5S2/c1-21-13-15-24(16-14-21)34(30,31)27-19-17-25(32-33(2,28)29)26(18-20-27,22-9-5-3-6-10-22)23-11-7-4-8-12-23/h3-16,25H,17-20H2,1-2H3 |
| InChIKey | DVAAYKAVUSTDLT-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 499.65 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [1-(4-methylphenyl)sulfonyl-5,5-diphenylazepan-4-yl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-methylphenyl)sulfonyl-5,5-diphenylazepan-4-yl] methanesulfonate?
The IUPAC name of [1-(4-methylphenyl)sulfonyl-5,5-diphenylazepan-4-yl] methanesulfonate (CID 54671603) is [1-(4-methylphenyl)sulfonyl-5,5-diphenylazepan-4-yl] methanesulfonate.
What is the SMILES notation for [1-(4-methylphenyl)sulfonyl-5,5-diphenylazepan-4-yl] methanesulfonate?
The canonical SMILES for [1-(4-methylphenyl)sulfonyl-5,5-diphenylazepan-4-yl] methanesulfonate is Cc1ccc(S(=O)(=O)N2CCC(OS(C)(=O)=O)C(c3ccccc3)(c3ccccc3)CC2)cc1.
What is the InChIKey of [1-(4-methylphenyl)sulfonyl-5,5-diphenylazepan-4-yl] methanesulfonate?
The InChIKey is DVAAYKAVUSTDLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H29NO5S2/c1-21-13-15-24(16-14-21)34(30,31)27-19-17-25(32-33(2,28)29)26(18-20-27,22-9-5-3-6-10-22)23-11-7-4-8-12-23/h3-16,25H,17-20H2,1-2H3.
What are the key properties of [1-(4-methylphenyl)sulfonyl-5,5-diphenylazepan-4-yl] methanesulfonate?
[1-(4-methylphenyl)sulfonyl-5,5-diphenylazepan-4-yl] methanesulfonate has a molecular weight of 499.65 g/mol, XLogP of 4.11, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-methylphenyl)sulfonyl-5,5-diphenylazepan-4-yl] methanesulfonate is sourced from PubChem (CID 54671603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).