About tert-butyl-cyclohexyloxy-dimethylsilane;iodozinc(1+)
tert-butyl-cyclohexyloxy-dimethylsilane;iodozinc(1+) (PubChem CID 54671613) has the molecular formula C12H25IOSiZn
and a molecular weight of 405.71 g/mol. Its IUPAC name is tert-butyl-cyclohexyloxy-dimethylsilane;iodozinc(1+).
Molecular Properties
| Compound Name | tert-butyl-cyclohexyloxy-dimethylsilane;iodozinc(1+) |
| PubChem CID | 54671613 |
| Molecular Formula | C12H25IOSiZn |
| Molecular Weight | 405.71 g/mol |
| Exact Mass | 404.00 |
| IUPAC Name | tert-butyl-cyclohexyloxy-dimethylsilane;iodozinc(1+) |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC[CH-]CC1.[Zn+]I |
| InChI | InChI=1S/C12H25OSi.HI.Zn/c1-12(2,3)14(4,5)13-11-9-7-6-8-10-11;;/h6,11H,7-10H2,1-5H3;1H;/q-1;;+2/p-1 |
| InChIKey | PABNMGQKQKXQGD-UHFFFAOYSA-M |
| XLogP | 5.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.71 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-cyclohexyloxy-dimethylsilane;iodozinc(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-cyclohexyloxy-dimethylsilane;iodozinc(1+)?
The IUPAC name of tert-butyl-cyclohexyloxy-dimethylsilane;iodozinc(1+) (CID 54671613) is tert-butyl-cyclohexyloxy-dimethylsilane;iodozinc(1+).
What is the SMILES notation for tert-butyl-cyclohexyloxy-dimethylsilane;iodozinc(1+)?
The canonical SMILES for tert-butyl-cyclohexyloxy-dimethylsilane;iodozinc(1+) is CC(C)(C)[Si](C)(C)OC1CC[CH-]CC1.[Zn+]I.
What is the InChIKey of tert-butyl-cyclohexyloxy-dimethylsilane;iodozinc(1+)?
The InChIKey is PABNMGQKQKXQGD-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H25OSi.HI.Zn/c1-12(2,3)14(4,5)13-11-9-7-6-8-10-11;;/h6,11H,7-10H2,1-5H3;1H;/q-1;;+2/p-1.
What are the key properties of tert-butyl-cyclohexyloxy-dimethylsilane;iodozinc(1+)?
tert-butyl-cyclohexyloxy-dimethylsilane;iodozinc(1+) has a molecular weight of 405.71 g/mol, XLogP of 5.04, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-cyclohexyloxy-dimethylsilane;iodozinc(1+) is sourced from PubChem (CID 54671613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).