About disodium;2,5-bis(ethoxycarbonyl)thiophene-3,4-diolate
disodium;2,5-bis(ethoxycarbonyl)thiophene-3,4-diolate (PubChem CID 54671964) has the molecular formula C10H10Na2O6S
and a molecular weight of 304.23 g/mol. Its IUPAC name is disodium;2,5-bis(ethoxycarbonyl)thiophene-3,4-diolate.
Molecular Properties
| Compound Name | disodium;2,5-bis(ethoxycarbonyl)thiophene-3,4-diolate |
| PubChem CID | 54671964 |
| Molecular Formula | C10H10Na2O6S |
| Molecular Weight | 304.23 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | disodium;2,5-bis(ethoxycarbonyl)thiophene-3,4-diolate |
| SMILES | CCOC(=O)c1sc(C(=O)OCC)c([O-])c1[O-].[Na+].[Na+] |
| InChI | InChI=1S/C10H12O6S.2Na/c1-3-15-9(13)7-5(11)6(12)8(17-7)10(14)16-4-2;;/h11-12H,3-4H2,1-2H3;;/q;2*+1/p-2 |
| InChIKey | PCSQVUZNLOEFFP-UHFFFAOYSA-L |
| XLogP | -5.74 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.23 |
| LogP ≤ 5 | -5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze disodium;2,5-bis(ethoxycarbonyl)thiophene-3,4-diolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;2,5-bis(ethoxycarbonyl)thiophene-3,4-diolate?
The IUPAC name of disodium;2,5-bis(ethoxycarbonyl)thiophene-3,4-diolate (CID 54671964) is disodium;2,5-bis(ethoxycarbonyl)thiophene-3,4-diolate.
What is the SMILES notation for disodium;2,5-bis(ethoxycarbonyl)thiophene-3,4-diolate?
The canonical SMILES for disodium;2,5-bis(ethoxycarbonyl)thiophene-3,4-diolate is CCOC(=O)c1sc(C(=O)OCC)c([O-])c1[O-].[Na+].[Na+].
What is the InChIKey of disodium;2,5-bis(ethoxycarbonyl)thiophene-3,4-diolate?
The InChIKey is PCSQVUZNLOEFFP-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H12O6S.2Na/c1-3-15-9(13)7-5(11)6(12)8(17-7)10(14)16-4-2;;/h11-12H,3-4H2,1-2H3;;/q;2*+1/p-2.
What are the key properties of disodium;2,5-bis(ethoxycarbonyl)thiophene-3,4-diolate?
disodium;2,5-bis(ethoxycarbonyl)thiophene-3,4-diolate has a molecular weight of 304.23 g/mol, XLogP of -5.74, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;2,5-bis(ethoxycarbonyl)thiophene-3,4-diolate is sourced from PubChem (CID 54671964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).