C21H30O5 — CID 54672265
(1R,13S,14S,18R,19S)-2,9,16-trioxatetracyclo[11.9.2.014,18.019,23]tetracos-23-ene-15,17-dione (PubChem CID 54672265) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is (1R,13S,14S,18R,19S)-2,9,16-trioxatetracyclo[11.9.2.014,18.019,23]tetracos-23-ene-15,17-dione.
| Compound Name | (1R,13S,14S,18R,19S)-2,9,16-trioxatetracyclo[11.9.2.014,18.019,23]tetracos-23-ene-15,17-dione |
|---|---|
| PubChem CID | 54672265 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | (1R,13S,14S,18R,19S)-2,9,16-trioxatetracyclo[11.9.2.014,18.019,23]tetracos-23-ene-15,17-dione |
| SMILES | O=C1OC(=O)[C@H]2[C@@H]1[C@@H]1C=C3[C@H]2CCC[C@H]3OCCCCCCOCCC1 |
| InChI | InChI=1S/C21H30O5/c22-20-18-14-7-6-11-24-10-3-1-2-4-12-25-17-9-5-8-15(16(17)13-14)19(18)21(23)26-20/h13-15,17-19H,1-12H2/t14-,15+,17+,18-,19+/m0/s1 |
| InChIKey | RXTVAGXKCCJVNF-CSQLCUNESA-N |
| XLogP | 3.41 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|