C20H15N5OS — CID 54672309
7-(4-methoxyphenyl)-11-phenyl-1,3,4,6,12-pentazatricyclo[7.3.0.02,6]dodeca-2,7,9,11-tetraene-5-thione (PubChem CID 54672309) has the molecular formula C20H15N5OS and a molecular weight of 373.44 g/mol. Its IUPAC name is 7-(4-methoxyphenyl)-11-phenyl-1,3,4,6,12-pentazatricyclo[7.3.0.02,6]dodeca-2,7,9,11-tetraene-5-thione.
| Compound Name | 7-(4-methoxyphenyl)-11-phenyl-1,3,4,6,12-pentazatricyclo[7.3.0.02,6]dodeca-2,7,9,11-tetraene-5-thione |
|---|---|
| PubChem CID | 54672309 |
| Molecular Formula | C20H15N5OS |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 7-(4-methoxyphenyl)-11-phenyl-1,3,4,6,12-pentazatricyclo[7.3.0.02,6]dodeca-2,7,9,11-tetraene-5-thione |
| SMILES | COc1ccc(-c2cc3cc(-c4ccccc4)nn3c3n[nH]c(=S)n23)cc1 |
| InChI | InChI=1S/C20H15N5OS/c1-26-16-9-7-14(8-10-16)18-12-15-11-17(13-5-3-2-4-6-13)23-25(15)19-21-22-20(27)24(18)19/h2-12H,1H3,(H,22,27) |
| InChIKey | WPNIXZCUWBQPCS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 59.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|