C22H40O8Si — CID 54672632
(2R,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-5-methoxycarbonyl-3-(methoxymethoxy)-3-methyl-2-pentyl-2,4-dihydropyran-6-carboxylic acid (PubChem CID 54672632) has the molecular formula C22H40O8Si and a molecular weight of 460.64 g/mol. Its IUPAC name is (2R,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-5-methoxycarbonyl-3-(methoxymethoxy)-3-methyl-2-pentyl-2,4-dihydropyran-6-carboxylic acid.
| Compound Name | (2R,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-5-methoxycarbonyl-3-(methoxymethoxy)-3-methyl-2-pentyl-2,4-dihydropyran-6-carboxylic acid |
|---|---|
| PubChem CID | 54672632 |
| Molecular Formula | C22H40O8Si |
| Molecular Weight | 460.64 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | (2R,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-5-methoxycarbonyl-3-(methoxymethoxy)-3-methyl-2-pentyl-2,4-dihydropyran-6-carboxylic acid |
| SMILES | CCCCC[C@H]1OC(C(=O)O)=C(C(=O)OC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@]1(C)OCOC |
| InChI | InChI=1S/C22H40O8Si/c1-10-11-12-13-15-22(5,28-14-26-6)18(30-31(8,9)21(2,3)4)16(20(25)27-7)17(29-15)19(23)24/h15,18H,10-14H2,1-9H3,(H,23,24)/t15-,18-,22+/m1/s1 |
| InChIKey | YNNISULDVHPUCO-LDJQZATESA-N |
| XLogP | 4.25 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.64 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|