C23H43NO8Si — CID 54672715
methyl (2R,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(methoxycarbamoyl)-3-(methoxymethoxy)-3-methyl-2-pentyl-2,4-dihydropyran-5-carboxylate (PubChem CID 54672715) has the molecular formula C23H43NO8Si and a molecular weight of 489.68 g/mol. Its IUPAC name is methyl (2R,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(methoxycarbamoyl)-3-(methoxymethoxy)-3-methyl-2-pentyl-2,4-dihydropyran-5-carboxylate.
| Compound Name | methyl (2R,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(methoxycarbamoyl)-3-(methoxymethoxy)-3-methyl-2-pentyl-2,4-dihydropyran-5-carboxylate |
|---|---|
| PubChem CID | 54672715 |
| Molecular Formula | C23H43NO8Si |
| Molecular Weight | 489.68 g/mol |
| Exact Mass | 489.28 |
| IUPAC Name | methyl (2R,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(methoxycarbamoyl)-3-(methoxymethoxy)-3-methyl-2-pentyl-2,4-dihydropyran-5-carboxylate |
| SMILES | CCCCC[C@H]1OC(C(=O)NOC)=C(C(=O)OC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@]1(C)OCOC |
| InChI | InChI=1S/C23H43NO8Si/c1-11-12-13-14-16-23(5,30-15-27-6)19(32-33(9,10)22(2,3)4)17(21(26)28-7)18(31-16)20(25)24-29-8/h16,19H,11-15H2,1-10H3,(H,24,25)/t16-,19-,23+/m1/s1 |
| InChIKey | JNYNGUNSXHXSNY-HFXUHXBXSA-N |
| XLogP | 3.84 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.68 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|