C25H26F3N3O3 — CID 54672781
(3R)-1-[(3aS,6aS)-5-(3-acetylbenzoyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 54672781) has the molecular formula C25H26F3N3O3 and a molecular weight of 473.50 g/mol. Its IUPAC name is (3R)-1-[(3aS,6aS)-5-(3-acetylbenzoyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | (3R)-1-[(3aS,6aS)-5-(3-acetylbenzoyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 54672781 |
| Molecular Formula | C25H26F3N3O3 |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | (3R)-1-[(3aS,6aS)-5-(3-acetylbenzoyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | CC(=O)c1cccc(C(=O)N2C[C@@H]3CCN(C(=O)C[C@H](N)Cc4cc(F)c(F)cc4F)[C@@H]3C2)c1 |
| InChI | InChI=1S/C25H26F3N3O3/c1-14(32)15-3-2-4-16(7-15)25(34)30-12-17-5-6-31(23(17)13-30)24(33)10-19(29)8-18-9-21(27)22(28)11-20(18)26/h2-4,7,9,11,17,19,23H,5-6,8,10,12-13,29H2,1H3/t17-,19+,23+/m0/s1 |
| InChIKey | SULLKPPBVZVYJO-GEQKSPFYSA-N |
| XLogP | 2.94 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|