C20H36ClNO2 — CID 5467302
(2E)-2-decylidene-5-(morpholin-4-ylmethyl)cyclopentan-1-one;hydrochloride (PubChem CID 5467302) has the molecular formula C20H36ClNO2 and a molecular weight of 357.97 g/mol. Its IUPAC name is (2E)-2-decylidene-5-(morpholin-4-ylmethyl)cyclopentan-1-one;hydrochloride.
| Compound Name | (2E)-2-decylidene-5-(morpholin-4-ylmethyl)cyclopentan-1-one;hydrochloride |
|---|---|
| PubChem CID | 5467302 |
| Molecular Formula | C20H36ClNO2 |
| Molecular Weight | 357.97 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | (2E)-2-decylidene-5-(morpholin-4-ylmethyl)cyclopentan-1-one;hydrochloride |
| SMILES | CCCCCCCCC/C=C1\CCC(CN2CCOCC2)C1=O.Cl |
| InChI | InChI=1S/C20H35NO2.ClH/c1-2-3-4-5-6-7-8-9-10-18-11-12-19(20(18)22)17-21-13-15-23-16-14-21;/h10,19H,2-9,11-17H2,1H3;1H/b18-10+; |
| InChIKey | MCGSOLCMSCYCAE-DYMYMWKRSA-N |
| XLogP | 4.79 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.97 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|