About N-[(Z)-2-(2,5-dihydroxyphenyl)ethenyl]formamide
N-[(Z)-2-(2,5-dihydroxyphenyl)ethenyl]formamide (PubChem CID 5467316) has the molecular formula C9H9NO3
and a molecular weight of 179.18 g/mol. Its IUPAC name is N-[(Z)-2-(2,5-dihydroxyphenyl)ethenyl]formamide.
Molecular Properties
| Compound Name | N-[(Z)-2-(2,5-dihydroxyphenyl)ethenyl]formamide |
| PubChem CID | 5467316 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | N-[(Z)-2-(2,5-dihydroxyphenyl)ethenyl]formamide |
| SMILES | O=CN/C=C\c1cc(O)ccc1O |
| InChI | InChI=1S/C9H9NO3/c11-6-10-4-3-7-5-8(12)1-2-9(7)13/h1-6,12-13H,(H,10,11)/b4-3- |
| InChIKey | SIHZWGODIRRSRA-ARJAWSKDSA-N |
| XLogP | 0.81 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-2-(2,5-dihydroxyphenyl)ethenyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-2-(2,5-dihydroxyphenyl)ethenyl]formamide?
The IUPAC name of N-[(Z)-2-(2,5-dihydroxyphenyl)ethenyl]formamide (CID 5467316) is N-[(Z)-2-(2,5-dihydroxyphenyl)ethenyl]formamide.
What is the SMILES notation for N-[(Z)-2-(2,5-dihydroxyphenyl)ethenyl]formamide?
The canonical SMILES for N-[(Z)-2-(2,5-dihydroxyphenyl)ethenyl]formamide is O=CN/C=C\c1cc(O)ccc1O.
What is the InChIKey of N-[(Z)-2-(2,5-dihydroxyphenyl)ethenyl]formamide?
The InChIKey is SIHZWGODIRRSRA-ARJAWSKDSA-N. The full InChI is InChI=1S/C9H9NO3/c11-6-10-4-3-7-5-8(12)1-2-9(7)13/h1-6,12-13H,(H,10,11)/b4-3-.
What are the key properties of N-[(Z)-2-(2,5-dihydroxyphenyl)ethenyl]formamide?
N-[(Z)-2-(2,5-dihydroxyphenyl)ethenyl]formamide has a molecular weight of 179.18 g/mol, XLogP of 0.81, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-2-(2,5-dihydroxyphenyl)ethenyl]formamide is sourced from PubChem (CID 5467316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).