C16H20F3N3O — CID 54673366
2-[[(3aR,4S,6aS)-2-[4-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]acetamide (PubChem CID 54673366) has the molecular formula C16H20F3N3O and a molecular weight of 327.35 g/mol. Its IUPAC name is 2-[[(3aR,4S,6aS)-2-[4-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]acetamide.
| Compound Name | 2-[[(3aR,4S,6aS)-2-[4-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]acetamide |
|---|---|
| PubChem CID | 54673366 |
| Molecular Formula | C16H20F3N3O |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 2-[[(3aR,4S,6aS)-2-[4-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]acetamide |
| SMILES | NC(=O)CN[C@H]1CC[C@@H]2CN(c3ccc(C(F)(F)F)cc3)C[C@@H]21 |
| InChI | InChI=1S/C16H20F3N3O/c17-16(18,19)11-2-4-12(5-3-11)22-8-10-1-6-14(13(10)9-22)21-7-15(20)23/h2-5,10,13-14,21H,1,6-9H2,(H2,20,23)/t10-,13+,14+/m1/s1 |
| InChIKey | LQENYFTVEFZGRZ-SWHYSGLUSA-N |
| XLogP | 2.00 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |