C37H37N5O5 — CID 54673392
methyl 9-[4-[1,3-dioxo-1,3-bis(quinolin-8-ylamino)propan-2-yl]anilino]-9-oxononanoate (PubChem CID 54673392) has the molecular formula C37H37N5O5 and a molecular weight of 631.73 g/mol. Its IUPAC name is methyl 9-[4-[1,3-dioxo-1,3-bis(quinolin-8-ylamino)propan-2-yl]anilino]-9-oxononanoate.
| Compound Name | methyl 9-[4-[1,3-dioxo-1,3-bis(quinolin-8-ylamino)propan-2-yl]anilino]-9-oxononanoate |
|---|---|
| PubChem CID | 54673392 |
| Molecular Formula | C37H37N5O5 |
| Molecular Weight | 631.73 g/mol |
| Exact Mass | 631.28 |
| IUPAC Name | methyl 9-[4-[1,3-dioxo-1,3-bis(quinolin-8-ylamino)propan-2-yl]anilino]-9-oxononanoate |
| SMILES | COC(=O)CCCCCCCC(=O)Nc1ccc(C(C(=O)Nc2cccc3cccnc23)C(=O)Nc2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C37H37N5O5/c1-47-32(44)18-6-4-2-3-5-17-31(43)40-28-21-19-25(20-22-28)33(36(45)41-29-15-7-11-26-13-9-23-38-34(26)29)37(46)42-30-16-8-12-27-14-10-24-39-35(27)30/h7-16,19-24,33H,2-6,17-18H2,1H3,(H,40,43)(H,41,45)(H,42,46) |
| InChIKey | AIVYHEUPSDCGKR-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 139.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.73 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|