C36H35N5O5 — CID 54673393
ethyl 7-[4-[1,3-dioxo-1,3-bis(quinolin-8-ylamino)propan-2-yl]anilino]-7-oxoheptanoate (PubChem CID 54673393) has the molecular formula C36H35N5O5 and a molecular weight of 617.71 g/mol. Its IUPAC name is ethyl 7-[4-[1,3-dioxo-1,3-bis(quinolin-8-ylamino)propan-2-yl]anilino]-7-oxoheptanoate.
| Compound Name | ethyl 7-[4-[1,3-dioxo-1,3-bis(quinolin-8-ylamino)propan-2-yl]anilino]-7-oxoheptanoate |
|---|---|
| PubChem CID | 54673393 |
| Molecular Formula | C36H35N5O5 |
| Molecular Weight | 617.71 g/mol |
| Exact Mass | 617.26 |
| IUPAC Name | ethyl 7-[4-[1,3-dioxo-1,3-bis(quinolin-8-ylamino)propan-2-yl]anilino]-7-oxoheptanoate |
| SMILES | CCOC(=O)CCCCCC(=O)Nc1ccc(C(C(=O)Nc2cccc3cccnc23)C(=O)Nc2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C36H35N5O5/c1-2-46-31(43)17-5-3-4-16-30(42)39-27-20-18-24(19-21-27)32(35(44)40-28-14-6-10-25-12-8-22-37-33(25)28)36(45)41-29-15-7-11-26-13-9-23-38-34(26)29/h6-15,18-23,32H,2-5,16-17H2,1H3,(H,39,42)(H,40,44)(H,41,45) |
| InChIKey | CYJTWCHKCBMMKN-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 139.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.71 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|