C10H11Cl3FNO — CID 54673468
1-fluoro-N-methoxy-3-(2,4,6-trichlorophenyl)propan-2-amine (PubChem CID 54673468) has the molecular formula C10H11Cl3FNO and a molecular weight of 286.56 g/mol. Its IUPAC name is 1-fluoro-N-methoxy-3-(2,4,6-trichlorophenyl)propan-2-amine.
| Compound Name | 1-fluoro-N-methoxy-3-(2,4,6-trichlorophenyl)propan-2-amine |
|---|---|
| PubChem CID | 54673468 |
| Molecular Formula | C10H11Cl3FNO |
| Molecular Weight | 286.56 g/mol |
| Exact Mass | 284.99 |
| IUPAC Name | 1-fluoro-N-methoxy-3-(2,4,6-trichlorophenyl)propan-2-amine |
| SMILES | CONC(CF)Cc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C10H11Cl3FNO/c1-16-15-7(5-14)4-8-9(12)2-6(11)3-10(8)13/h2-3,7,15H,4-5H2,1H3 |
| InChIKey | IAMMLPQKKPQTCP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.56 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|