C14H18N2O3 — CID 54673510
(3aS,10bR)-8,10-dimethoxy-2,3,3a,4,5,10b-hexahydro-1H-pyrrolo[3,4-d][2]benzazepin-6-one (PubChem CID 54673510) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is (3aS,10bR)-8,10-dimethoxy-2,3,3a,4,5,10b-hexahydro-1H-pyrrolo[3,4-d][2]benzazepin-6-one.
| Compound Name | (3aS,10bR)-8,10-dimethoxy-2,3,3a,4,5,10b-hexahydro-1H-pyrrolo[3,4-d][2]benzazepin-6-one |
|---|---|
| PubChem CID | 54673510 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | (3aS,10bR)-8,10-dimethoxy-2,3,3a,4,5,10b-hexahydro-1H-pyrrolo[3,4-d][2]benzazepin-6-one |
| SMILES | COc1cc(OC)c2c(c1)C(=O)NC[C@@H]1CNC[C@@H]21 |
| InChI | InChI=1S/C14H18N2O3/c1-18-9-3-10-13(12(4-9)19-2)11-7-15-5-8(11)6-16-14(10)17/h3-4,8,11,15H,5-7H2,1-2H3,(H,16,17)/t8-,11+/m0/s1 |
| InChIKey | VYTFXYCAPAOMDG-GZMMTYOYSA-N |
| XLogP | 0.75 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |