About 1-[(E)-3-phenylprop-2-enoxy]piperidine-3,4,5-triol
1-[(E)-3-phenylprop-2-enoxy]piperidine-3,4,5-triol (PubChem CID 5467384) has the molecular formula C14H19NO4
and a molecular weight of 265.31 g/mol. Its IUPAC name is 1-[(E)-3-phenylprop-2-enoxy]piperidine-3,4,5-triol.
Molecular Properties
| Compound Name | 1-[(E)-3-phenylprop-2-enoxy]piperidine-3,4,5-triol |
| PubChem CID | 5467384 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 1-[(E)-3-phenylprop-2-enoxy]piperidine-3,4,5-triol |
| SMILES | OC1CN(OC/C=C/c2ccccc2)CC(O)C1O |
| InChI | InChI=1S/C14H19NO4/c16-12-9-15(10-13(17)14(12)18)19-8-4-7-11-5-2-1-3-6-11/h1-7,12-14,16-18H,8-10H2/b7-4+ |
| InChIKey | PTMZDVVIWWFPQK-QPJJXVBHSA-N |
| XLogP | 0.03 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(E)-3-phenylprop-2-enoxy]piperidine-3,4,5-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-3-phenylprop-2-enoxy]piperidine-3,4,5-triol?
The IUPAC name of 1-[(E)-3-phenylprop-2-enoxy]piperidine-3,4,5-triol (CID 5467384) is 1-[(E)-3-phenylprop-2-enoxy]piperidine-3,4,5-triol.
What is the SMILES notation for 1-[(E)-3-phenylprop-2-enoxy]piperidine-3,4,5-triol?
The canonical SMILES for 1-[(E)-3-phenylprop-2-enoxy]piperidine-3,4,5-triol is OC1CN(OC/C=C/c2ccccc2)CC(O)C1O.
What is the InChIKey of 1-[(E)-3-phenylprop-2-enoxy]piperidine-3,4,5-triol?
The InChIKey is PTMZDVVIWWFPQK-QPJJXVBHSA-N. The full InChI is InChI=1S/C14H19NO4/c16-12-9-15(10-13(17)14(12)18)19-8-4-7-11-5-2-1-3-6-11/h1-7,12-14,16-18H,8-10H2/b7-4+.
What are the key properties of 1-[(E)-3-phenylprop-2-enoxy]piperidine-3,4,5-triol?
1-[(E)-3-phenylprop-2-enoxy]piperidine-3,4,5-triol has a molecular weight of 265.31 g/mol, XLogP of 0.03, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-3-phenylprop-2-enoxy]piperidine-3,4,5-triol is sourced from PubChem (CID 5467384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).