C26H29FN6O2 — CID 54673903
5-[5-amino-6-[3-[4-[(2-fluoroethylamino)methyl]phenyl]-1,2-oxazol-5-yl]pyrazin-2-yl]-1-pentan-3-ylpyridin-2-one (PubChem CID 54673903) has the molecular formula C26H29FN6O2 and a molecular weight of 476.56 g/mol. Its IUPAC name is 5-[5-amino-6-[3-[4-[(2-fluoroethylamino)methyl]phenyl]-1,2-oxazol-5-yl]pyrazin-2-yl]-1-pentan-3-ylpyridin-2-one.
| Compound Name | 5-[5-amino-6-[3-[4-[(2-fluoroethylamino)methyl]phenyl]-1,2-oxazol-5-yl]pyrazin-2-yl]-1-pentan-3-ylpyridin-2-one |
|---|---|
| PubChem CID | 54673903 |
| Molecular Formula | C26H29FN6O2 |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 5-[5-amino-6-[3-[4-[(2-fluoroethylamino)methyl]phenyl]-1,2-oxazol-5-yl]pyrazin-2-yl]-1-pentan-3-ylpyridin-2-one |
| SMILES | CCC(CC)n1cc(-c2cnc(N)c(-c3cc(-c4ccc(CNCCF)cc4)no3)n2)ccc1=O |
| InChI | InChI=1S/C26H29FN6O2/c1-3-20(4-2)33-16-19(9-10-24(33)34)22-15-30-26(28)25(31-22)23-13-21(32-35-23)18-7-5-17(6-8-18)14-29-12-11-27/h5-10,13,15-16,20,29H,3-4,11-12,14H2,1-2H3,(H2,28,30) |
| InChIKey | RQBSUPMMDBBQRW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 111.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|