C18H22F2N4O2S2 — CID 54674122
(2R,3S,5R)-2-(2,5-difluorophenyl)-5-(2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)thiepan-3-amine (PubChem CID 54674122) has the molecular formula C18H22F2N4O2S2 and a molecular weight of 428.53 g/mol. Its IUPAC name is (2R,3S,5R)-2-(2,5-difluorophenyl)-5-(2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)thiepan-3-amine.
| Compound Name | (2R,3S,5R)-2-(2,5-difluorophenyl)-5-(2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)thiepan-3-amine |
|---|---|
| PubChem CID | 54674122 |
| Molecular Formula | C18H22F2N4O2S2 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | (2R,3S,5R)-2-(2,5-difluorophenyl)-5-(2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)thiepan-3-amine |
| SMILES | CS(=O)(=O)n1cc2c(n1)CN([C@H]1CCS[C@H](c3cc(F)ccc3F)[C@@H](N)C1)C2 |
| InChI | InChI=1S/C18H22F2N4O2S2/c1-28(25,26)24-9-11-8-23(10-17(11)22-24)13-4-5-27-18(16(21)7-13)14-6-12(19)2-3-15(14)20/h2-3,6,9,13,16,18H,4-5,7-8,10,21H2,1H3/t13-,16-,18+/m0/s1 |
| InChIKey | PDTMGCHVHVHPJV-QANKJYHBSA-N |
| XLogP | 2.25 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |