C24H17ClF6N6O — CID 54675244
4-amino-2-[5-chloro-3-(3,3,4,4,4-pentafluorobutyl)indazol-1-yl]-5-(3-fluorophenyl)-5-methyl-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 54675244) has the molecular formula C24H17ClF6N6O and a molecular weight of 554.88 g/mol. Its IUPAC name is 4-amino-2-[5-chloro-3-(3,3,4,4,4-pentafluorobutyl)indazol-1-yl]-5-(3-fluorophenyl)-5-methyl-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-2-[5-chloro-3-(3,3,4,4,4-pentafluorobutyl)indazol-1-yl]-5-(3-fluorophenyl)-5-methyl-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 54675244 |
| Molecular Formula | C24H17ClF6N6O |
| Molecular Weight | 554.88 g/mol |
| Exact Mass | 554.11 |
| IUPAC Name | 4-amino-2-[5-chloro-3-(3,3,4,4,4-pentafluorobutyl)indazol-1-yl]-5-(3-fluorophenyl)-5-methyl-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CC1(c2cccc(F)c2)C(=O)Nc2nc(-n3nc(CCC(F)(F)C(F)(F)F)c4cc(Cl)ccc43)nc(N)c21 |
| InChI | InChI=1S/C24H17ClF6N6O/c1-22(11-3-2-4-13(26)9-11)17-18(32)33-21(35-19(17)34-20(22)38)37-16-6-5-12(25)10-14(16)15(36-37)7-8-23(27,28)24(29,30)31/h2-6,9-10H,7-8H2,1H3,(H3,32,33,34,35,38) |
| InChIKey | CXAYWEVNJOJVLE-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.88 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|