C20H26O2S — CID 5467538
(3'S,10'Z)-3'-phenylsulfanylspiro[1,3-dioxolane-2,4'-2,3,3a,5,6,7,8,9-octahydro-1H-cyclopenta[9]annulene] (PubChem CID 5467538) has the molecular formula C20H26O2S and a molecular weight of 330.49 g/mol. Its IUPAC name is (3'S,10'Z)-3'-phenylsulfanylspiro[1,3-dioxolane-2,4'-2,3,3a,5,6,7,8,9-octahydro-1H-cyclopenta[9]annulene].
| Compound Name | (3'S,10'Z)-3'-phenylsulfanylspiro[1,3-dioxolane-2,4'-2,3,3a,5,6,7,8,9-octahydro-1H-cyclopenta[9]annulene] |
|---|---|
| PubChem CID | 5467538 |
| Molecular Formula | C20H26O2S |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (3'S,10'Z)-3'-phenylsulfanylspiro[1,3-dioxolane-2,4'-2,3,3a,5,6,7,8,9-octahydro-1H-cyclopenta[9]annulene] |
| SMILES | C1=C2/CC[C@H](Sc3ccccc3)C2C2(CCCCC/1)OCCO2 |
| InChI | InChI=1S/C20H26O2S/c1-2-7-13-20(21-14-15-22-20)19-16(8-4-1)11-12-18(19)23-17-9-5-3-6-10-17/h3,5-6,8-10,18-19H,1-2,4,7,11-15H2/b16-8-/t18-,19?/m0/s1 |
| InChIKey | IFZRGLLWHBHOTE-DCRDRLAGSA-N |
| XLogP | 5.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|