C18H22OS — CID 5467539
(3S,3aR,10Z)-3-phenylsulfanyl-2,3,3a,5,6,7,8,9-octahydro-1H-cyclopenta[9]annulen-4-one (PubChem CID 5467539) has the molecular formula C18H22OS and a molecular weight of 286.44 g/mol. Its IUPAC name is (3S,3aR,10Z)-3-phenylsulfanyl-2,3,3a,5,6,7,8,9-octahydro-1H-cyclopenta[9]annulen-4-one.
| Compound Name | (3S,3aR,10Z)-3-phenylsulfanyl-2,3,3a,5,6,7,8,9-octahydro-1H-cyclopenta[9]annulen-4-one |
|---|---|
| PubChem CID | 5467539 |
| Molecular Formula | C18H22OS |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (3S,3aR,10Z)-3-phenylsulfanyl-2,3,3a,5,6,7,8,9-octahydro-1H-cyclopenta[9]annulen-4-one |
| SMILES | O=C1CCCCC/C=C2/CC[C@H](Sc3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C18H22OS/c19-16-11-7-2-1-4-8-14-12-13-17(18(14)16)20-15-9-5-3-6-10-15/h3,5-6,8-10,17-18H,1-2,4,7,11-13H2/b14-8-/t17-,18+/m0/s1 |
| InChIKey | KWXGJKUBWQUIKN-VECLJIIPSA-N |
| XLogP | 5.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|