About 3-[(6-bromo-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-N-methylbenzenesulfonamide
3-[(6-bromo-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-N-methylbenzenesulfonamide (PubChem CID 54675446) has the molecular formula C13H12BrN5O2S
and a molecular weight of 382.24 g/mol. Its IUPAC name is 3-[(6-bromo-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-N-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | 3-[(6-bromo-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-N-methylbenzenesulfonamide |
| PubChem CID | 54675446 |
| Molecular Formula | C13H12BrN5O2S |
| Molecular Weight | 382.24 g/mol |
| Exact Mass | 380.99 |
| IUPAC Name | 3-[(6-bromo-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cccc(Nc2ncnc3[nH]c(Br)cc23)c1 |
| InChI | InChI=1S/C13H12BrN5O2S/c1-15-22(20,21)9-4-2-3-8(5-9)18-12-10-6-11(14)19-13(10)17-7-16-12/h2-7,15H,1H3,(H2,16,17,18,19) |
| InChIKey | CGGLCGPBRBEBNW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.24 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(6-bromo-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-N-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(6-bromo-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-N-methylbenzenesulfonamide?
The IUPAC name of 3-[(6-bromo-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-N-methylbenzenesulfonamide (CID 54675446) is 3-[(6-bromo-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-N-methylbenzenesulfonamide.
What is the SMILES notation for 3-[(6-bromo-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-N-methylbenzenesulfonamide?
The canonical SMILES for 3-[(6-bromo-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-N-methylbenzenesulfonamide is CNS(=O)(=O)c1cccc(Nc2ncnc3[nH]c(Br)cc23)c1.
What is the InChIKey of 3-[(6-bromo-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-N-methylbenzenesulfonamide?
The InChIKey is CGGLCGPBRBEBNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12BrN5O2S/c1-15-22(20,21)9-4-2-3-8(5-9)18-12-10-6-11(14)19-13(10)17-7-16-12/h2-7,15H,1H3,(H2,16,17,18,19).
What are the key properties of 3-[(6-bromo-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-N-methylbenzenesulfonamide?
3-[(6-bromo-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-N-methylbenzenesulfonamide has a molecular weight of 382.24 g/mol, XLogP of 2.37, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6-bromo-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-N-methylbenzenesulfonamide is sourced from PubChem (CID 54675446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).