C23H17ClF5N7O — CID 54675589
4-amino-5-(5-chloro-2-pyridinyl)-5-methyl-2-[3-(3,3,4,4,4-pentafluorobutyl)imidazo[1,5-a]pyridin-1-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 54675589) has the molecular formula C23H17ClF5N7O and a molecular weight of 537.88 g/mol. Its IUPAC name is 4-amino-5-(5-chloro-2-pyridinyl)-5-methyl-2-[3-(3,3,4,4,4-pentafluorobutyl)imidazo[1,5-a]pyridin-1-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-5-(5-chloro-2-pyridinyl)-5-methyl-2-[3-(3,3,4,4,4-pentafluorobutyl)imidazo[1,5-a]pyridin-1-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 54675589 |
| Molecular Formula | C23H17ClF5N7O |
| Molecular Weight | 537.88 g/mol |
| Exact Mass | 537.11 |
| IUPAC Name | 4-amino-5-(5-chloro-2-pyridinyl)-5-methyl-2-[3-(3,3,4,4,4-pentafluorobutyl)imidazo[1,5-a]pyridin-1-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CC1(c2ccc(Cl)cn2)C(=O)Nc2nc(-c3nc(CCC(F)(F)C(F)(F)F)n4ccccc34)nc(N)c21 |
| InChI | InChI=1S/C23H17ClF5N7O/c1-21(13-6-5-11(24)10-31-13)15-17(30)33-19(34-18(15)35-20(21)37)16-12-4-2-3-9-36(12)14(32-16)7-8-22(25,26)23(27,28)29/h2-6,9-10H,7-8H2,1H3,(H3,30,33,34,35,37) |
| InChIKey | QMAQUJQWPNNYLA-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 111.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.88 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|