C18H22N6O3S — CID 54675598
4-cyclohexyloxy-N-methyl-3-(7H-purin-6-ylamino)benzenesulfonamide (PubChem CID 54675598) has the molecular formula C18H22N6O3S and a molecular weight of 402.48 g/mol. Its IUPAC name is 4-cyclohexyloxy-N-methyl-3-(7H-purin-6-ylamino)benzenesulfonamide.
| Compound Name | 4-cyclohexyloxy-N-methyl-3-(7H-purin-6-ylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 54675598 |
| Molecular Formula | C18H22N6O3S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 4-cyclohexyloxy-N-methyl-3-(7H-purin-6-ylamino)benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(OC2CCCCC2)c(Nc2ncnc3nc[nH]c23)c1 |
| InChI | InChI=1S/C18H22N6O3S/c1-19-28(25,26)13-7-8-15(27-12-5-3-2-4-6-12)14(9-13)24-18-16-17(21-10-20-16)22-11-23-18/h7-12,19H,2-6H2,1H3,(H2,20,21,22,23,24) |
| InChIKey | XBDVKFFUDRXBFS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 121.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |