C23H16ClF6N7O — CID 54675625
4-amino-2-[6-chloro-3-(3,3,4,4,4-pentafluorobutyl)imidazo[1,5-a]pyridin-1-yl]-5-(5-fluoro-2-pyridinyl)-5-methyl-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 54675625) has the molecular formula C23H16ClF6N7O and a molecular weight of 555.87 g/mol. Its IUPAC name is 4-amino-2-[6-chloro-3-(3,3,4,4,4-pentafluorobutyl)imidazo[1,5-a]pyridin-1-yl]-5-(5-fluoro-2-pyridinyl)-5-methyl-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-2-[6-chloro-3-(3,3,4,4,4-pentafluorobutyl)imidazo[1,5-a]pyridin-1-yl]-5-(5-fluoro-2-pyridinyl)-5-methyl-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 54675625 |
| Molecular Formula | C23H16ClF6N7O |
| Molecular Weight | 555.87 g/mol |
| Exact Mass | 555.10 |
| IUPAC Name | 4-amino-2-[6-chloro-3-(3,3,4,4,4-pentafluorobutyl)imidazo[1,5-a]pyridin-1-yl]-5-(5-fluoro-2-pyridinyl)-5-methyl-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CC1(c2ccc(F)cn2)C(=O)Nc2nc(-c3nc(CCC(F)(F)C(F)(F)F)n4cc(Cl)ccc34)nc(N)c21 |
| InChI | InChI=1S/C23H16ClF6N7O/c1-21(13-5-3-11(25)8-32-13)15-17(31)34-19(35-18(15)36-20(21)38)16-12-4-2-10(24)9-37(12)14(33-16)6-7-22(26,27)23(28,29)30/h2-5,8-9H,6-7H2,1H3,(H3,31,34,35,36,38) |
| InChIKey | HPMGDRTXYGFIPG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 111.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.87 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|