C20H13F8N9O2 — CID 54675681
4-amino-5-methyl-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-5-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 54675681) has the molecular formula C20H13F8N9O2 and a molecular weight of 563.37 g/mol. Its IUPAC name is 4-amino-5-methyl-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-5-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-5-methyl-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-5-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 54675681 |
| Molecular Formula | C20H13F8N9O2 |
| Molecular Weight | 563.37 g/mol |
| Exact Mass | 563.11 |
| IUPAC Name | 4-amino-5-methyl-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-5-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CC1(c2nc(C(F)(F)F)no2)C(=O)Nc2nc(-c3nn(CCC(F)(F)C(F)(F)F)c4ncccc34)nc(N)c21 |
| InChI | InChI=1S/C20H13F8N9O2/c1-17(16-34-14(36-39-16)19(23,24)25)8-10(29)31-12(32-11(8)33-15(17)38)9-7-3-2-5-30-13(7)37(35-9)6-4-18(21,22)20(26,27)28/h2-3,5H,4,6H2,1H3,(H3,29,31,32,33,38) |
| InChIKey | SGIFXROVPDPNJA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 150.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|