C20H19F5N8O2 — CID 54675708
N,5-dimethyl-4-(methylamino)-6-oxo-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide (PubChem CID 54675708) has the molecular formula C20H19F5N8O2 and a molecular weight of 498.42 g/mol. Its IUPAC name is N,5-dimethyl-4-(methylamino)-6-oxo-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | N,5-dimethyl-4-(methylamino)-6-oxo-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 54675708 |
| Molecular Formula | C20H19F5N8O2 |
| Molecular Weight | 498.42 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | N,5-dimethyl-4-(methylamino)-6-oxo-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide |
| SMILES | CNC(=O)C1(C)C(=O)Nc2nc(-c3nn(CCC(F)(F)C(F)(F)F)c4ncccc34)nc(NC)c21 |
| InChI | InChI=1S/C20H19F5N8O2/c1-18(16(34)27-3)10-12(26-2)29-14(30-13(10)31-17(18)35)11-9-5-4-7-28-15(9)33(32-11)8-6-19(21,22)20(23,24)25/h4-5,7H,6,8H2,1-3H3,(H,27,34)(H2,26,29,30,31,35) |
| InChIKey | HSFLKUUQILZCHB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 126.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|