C21H19F5N10O — CID 54675735
4-amino-5-(1-ethyltriazol-4-yl)-5-methyl-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 54675735) has the molecular formula C21H19F5N10O and a molecular weight of 522.44 g/mol. Its IUPAC name is 4-amino-5-(1-ethyltriazol-4-yl)-5-methyl-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-5-(1-ethyltriazol-4-yl)-5-methyl-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 54675735 |
| Molecular Formula | C21H19F5N10O |
| Molecular Weight | 522.44 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | 4-amino-5-(1-ethyltriazol-4-yl)-5-methyl-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CCn1cc(C2(C)C(=O)Nc3nc(-c4nn(CCC(F)(F)C(F)(F)F)c5ncccc45)nc(N)c32)nn1 |
| InChI | InChI=1S/C21H19F5N10O/c1-3-35-9-11(32-34-35)19(2)12-14(27)29-16(30-15(12)31-18(19)37)13-10-5-4-7-28-17(10)36(33-13)8-6-20(22,23)21(24,25)26/h4-5,7,9H,3,6,8H2,1-2H3,(H3,27,29,30,31,37) |
| InChIKey | WFOHPSPGOISBQK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 142.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|