About 2-(5-carboxy-1-hydroxy-5-oxopenta-1,3-dienyl)phenolate
2-(5-carboxy-1-hydroxy-5-oxopenta-1,3-dienyl)phenolate (PubChem CID 54675849) has the molecular formula C12H9O5-
and a molecular weight of 233.20 g/mol. Its IUPAC name is 2-(5-carboxy-1-hydroxy-5-oxopenta-1,3-dienyl)phenolate.
Molecular Properties
| Compound Name | 2-(5-carboxy-1-hydroxy-5-oxopenta-1,3-dienyl)phenolate |
| PubChem CID | 54675849 |
| Molecular Formula | C12H9O5- |
| Molecular Weight | 233.20 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 2-(5-carboxy-1-hydroxy-5-oxopenta-1,3-dienyl)phenolate |
| SMILES | O=C(O)C(=O)C=CC=C(O)c1ccccc1[O-] |
| InChI | InChI=1S/C12H10O5/c13-9-5-2-1-4-8(9)10(14)6-3-7-11(15)12(16)17/h1-7,13-14H,(H,16,17)/p-1 |
| InChIKey | HNVBUXTUHPMTRW-UHFFFAOYSA-M |
| XLogP | 0.87 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.20 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-carboxy-1-hydroxy-5-oxopenta-1,3-dienyl)phenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-carboxy-1-hydroxy-5-oxopenta-1,3-dienyl)phenolate?
The IUPAC name of 2-(5-carboxy-1-hydroxy-5-oxopenta-1,3-dienyl)phenolate (CID 54675849) is 2-(5-carboxy-1-hydroxy-5-oxopenta-1,3-dienyl)phenolate.
What is the SMILES notation for 2-(5-carboxy-1-hydroxy-5-oxopenta-1,3-dienyl)phenolate?
The canonical SMILES for 2-(5-carboxy-1-hydroxy-5-oxopenta-1,3-dienyl)phenolate is O=C(O)C(=O)C=CC=C(O)c1ccccc1[O-].
What is the InChIKey of 2-(5-carboxy-1-hydroxy-5-oxopenta-1,3-dienyl)phenolate?
The InChIKey is HNVBUXTUHPMTRW-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H10O5/c13-9-5-2-1-4-8(9)10(14)6-3-7-11(15)12(16)17/h1-7,13-14H,(H,16,17)/p-1.
What are the key properties of 2-(5-carboxy-1-hydroxy-5-oxopenta-1,3-dienyl)phenolate?
2-(5-carboxy-1-hydroxy-5-oxopenta-1,3-dienyl)phenolate has a molecular weight of 233.20 g/mol, XLogP of 0.87, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-carboxy-1-hydroxy-5-oxopenta-1,3-dienyl)phenolate is sourced from PubChem (CID 54675849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).