C9H11O4- — CID 54675856
(2E,4Z)-1-hydroxy-7-methyl-1,6-dioxoocta-2,4-dien-2-olate (PubChem CID 54675856) has the molecular formula C9H11O4- and a molecular weight of 183.18 g/mol. Its IUPAC name is (2E,4Z)-1-hydroxy-7-methyl-1,6-dioxoocta-2,4-dien-2-olate.
| Compound Name | (2E,4Z)-1-hydroxy-7-methyl-1,6-dioxoocta-2,4-dien-2-olate |
|---|---|
| PubChem CID | 54675856 |
| Molecular Formula | C9H11O4- |
| Molecular Weight | 183.18 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | (2E,4Z)-1-hydroxy-7-methyl-1,6-dioxoocta-2,4-dien-2-olate |
| SMILES | CC(C)C(=O)/C=C\C=C(\[O-])C(=O)O |
| InChI | InChI=1S/C9H12O4/c1-6(2)7(10)4-3-5-8(11)9(12)13/h3-6,11H,1-2H3,(H,12,13)/p-1/b4-3-,8-5+ |
| InChIKey | OEUMAONYVQQDBW-HMRFFJRGSA-M |
| XLogP | 0.10 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.18 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|