C16H14O10 — CID 54676013
tetramethyl 5-hydroxy-2-oxo-1H-pentalene-1,3,4,6-tetracarboxylate (PubChem CID 54676013) has the molecular formula C16H14O10 and a molecular weight of 366.28 g/mol. Its IUPAC name is tetramethyl 5-hydroxy-2-oxo-1H-pentalene-1,3,4,6-tetracarboxylate.
| Compound Name | tetramethyl 5-hydroxy-2-oxo-1H-pentalene-1,3,4,6-tetracarboxylate |
|---|---|
| PubChem CID | 54676013 |
| Molecular Formula | C16H14O10 |
| Molecular Weight | 366.28 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | tetramethyl 5-hydroxy-2-oxo-1H-pentalene-1,3,4,6-tetracarboxylate |
| SMILES | COC(=O)C1=C(O)C(C(=O)OC)=C2C1=C(C(=O)OC)C(=O)C2C(=O)OC |
| InChI | InChI=1S/C16H14O10/c1-23-13(19)7-5-6(9(11(7)17)15(21)25-3)10(16(22)26-4)12(18)8(5)14(20)24-2/h7,18H,1-4H3 |
| InChIKey | QAZLKCUHFKTPTH-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.28 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|