C30H48O6 — CID 54676271
4-hydroxy-3-(2-hydroxyethyl)-6-[(4E,6E,9Z)-3-hydroxy-8-(hydroxymethyl)-2,6,10,12-tetramethyloctadeca-4,6,9-trien-2-yl]pyran-2-one (PubChem CID 54676271) has the molecular formula C30H48O6 and a molecular weight of 504.71 g/mol. Its IUPAC name is 4-hydroxy-3-(2-hydroxyethyl)-6-[(4E,6E,9Z)-3-hydroxy-8-(hydroxymethyl)-2,6,10,12-tetramethyloctadeca-4,6,9-trien-2-yl]pyran-2-one.
| Compound Name | 4-hydroxy-3-(2-hydroxyethyl)-6-[(4E,6E,9Z)-3-hydroxy-8-(hydroxymethyl)-2,6,10,12-tetramethyloctadeca-4,6,9-trien-2-yl]pyran-2-one |
|---|---|
| PubChem CID | 54676271 |
| Molecular Formula | C30H48O6 |
| Molecular Weight | 504.71 g/mol |
| Exact Mass | 504.35 |
| IUPAC Name | 4-hydroxy-3-(2-hydroxyethyl)-6-[(4E,6E,9Z)-3-hydroxy-8-(hydroxymethyl)-2,6,10,12-tetramethyloctadeca-4,6,9-trien-2-yl]pyran-2-one |
| SMILES | CCCCCCC(C)C/C(C)=C\C(/C=C(C)/C=C/C(O)C(C)(C)c1cc(O)c(CCO)c(=O)o1)CO |
| InChI | InChI=1S/C30H48O6/c1-7-8-9-10-11-21(2)16-23(4)18-24(20-32)17-22(3)12-13-27(34)30(5,6)28-19-26(33)25(14-15-31)29(35)36-28/h12-13,17-19,21,24,27,31-34H,7-11,14-16,20H2,1-6H3/b13-12+,22-17+,23-18- |
| InChIKey | FFTOWXZOJFEINY-YJBWKGOYSA-N |
| XLogP | 5.57 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.71 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|