C32H48O6 — CID 54676275
3-[4-hydroxy-7,7-dimethyl-3-(2-methylbutanoyl)-4a,6-bis(3-methylbut-2-enyl)-2-oxo-5,6-dihydrochromen-8-yl]hexanoic acid (PubChem CID 54676275) has the molecular formula C32H48O6 and a molecular weight of 528.73 g/mol. Its IUPAC name is 3-[4-hydroxy-7,7-dimethyl-3-(2-methylbutanoyl)-4a,6-bis(3-methylbut-2-enyl)-2-oxo-5,6-dihydrochromen-8-yl]hexanoic acid.
| Compound Name | 3-[4-hydroxy-7,7-dimethyl-3-(2-methylbutanoyl)-4a,6-bis(3-methylbut-2-enyl)-2-oxo-5,6-dihydrochromen-8-yl]hexanoic acid |
|---|---|
| PubChem CID | 54676275 |
| Molecular Formula | C32H48O6 |
| Molecular Weight | 528.73 g/mol |
| Exact Mass | 528.35 |
| IUPAC Name | 3-[4-hydroxy-7,7-dimethyl-3-(2-methylbutanoyl)-4a,6-bis(3-methylbut-2-enyl)-2-oxo-5,6-dihydrochromen-8-yl]hexanoic acid |
| SMILES | CCCC(CC(=O)O)C1=C2OC(=O)C(C(=O)C(C)CC)=C(O)C2(CC=C(C)C)CC(CC=C(C)C)C1(C)C |
| InChI | InChI=1S/C32H48O6/c1-10-12-22(17-24(33)34)26-29-32(16-15-20(5)6,18-23(31(26,8)9)14-13-19(3)4)28(36)25(30(37)38-29)27(35)21(7)11-2/h13,15,21-23,36H,10-12,14,16-18H2,1-9H3,(H,33,34) |
| InChIKey | NMCNUIUHSCNFEG-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.73 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|