C20H32Br8 — CID 5467633
(Z)-1,6,7-tribromo-3-(bromomethyl)-7-methyloct-2-ene;(E)-1,6,7-tribromo-3-(bromomethyl)-7-methyloct-2-ene (PubChem CID 5467633) has the molecular formula C20H32Br8 and a molecular weight of 911.71 g/mol. Its IUPAC name is (Z)-1,6,7-tribromo-3-(bromomethyl)-7-methyloct-2-ene;(E)-1,6,7-tribromo-3-(bromomethyl)-7-methyloct-2-ene.
| Compound Name | (Z)-1,6,7-tribromo-3-(bromomethyl)-7-methyloct-2-ene;(E)-1,6,7-tribromo-3-(bromomethyl)-7-methyloct-2-ene |
|---|---|
| PubChem CID | 5467633 |
| Molecular Formula | C20H32Br8 |
| Molecular Weight | 911.71 g/mol |
| Exact Mass | 903.60 |
| IUPAC Name | (Z)-1,6,7-tribromo-3-(bromomethyl)-7-methyloct-2-ene;(E)-1,6,7-tribromo-3-(bromomethyl)-7-methyloct-2-ene |
| SMILES | CC(C)(Br)C(Br)CC/C(=C/CBr)CBr.CC(C)(Br)C(Br)CC/C(=C\CBr)CBr |
| InChI | InChI=1S/2C10H16Br4/c2*1-10(2,14)9(13)4-3-8(7-12)5-6-11/h2*5,9H,3-4,6-7H2,1-2H3/b8-5+;8-5- |
| InChIKey | YGZHIWZFFTYLOA-OJEMXQENSA-N |
| XLogP | 10.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.71 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|