C13H12N2O2S — CID 54676439
11-ethyl-6-hydroxy-12-methyl-8-thia-3,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5,10,12-pentaen-4-one (PubChem CID 54676439) has the molecular formula C13H12N2O2S and a molecular weight of 260.32 g/mol. Its IUPAC name is 11-ethyl-6-hydroxy-12-methyl-8-thia-3,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5,10,12-pentaen-4-one.
| Compound Name | 11-ethyl-6-hydroxy-12-methyl-8-thia-3,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5,10,12-pentaen-4-one |
|---|---|
| PubChem CID | 54676439 |
| Molecular Formula | C13H12N2O2S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 11-ethyl-6-hydroxy-12-methyl-8-thia-3,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5,10,12-pentaen-4-one |
| SMILES | CCc1nc2sc3c(O)cc(=O)[nH]c3c2cc1C |
| InChI | InChI=1S/C13H12N2O2S/c1-3-8-6(2)4-7-11-12(18-13(7)14-8)9(16)5-10(17)15-11/h4-5H,3H2,1-2H3,(H2,15,16,17) |
| InChIKey | QWMOYZZAFHNQKO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |