About (2R)-2-(1,2-dihydroxyethyl)-3,4-dihydroxy-2H-furan-5-one
(2R)-2-(1,2-dihydroxyethyl)-3,4-dihydroxy-2H-furan-5-one (PubChem CID 54676536) has the molecular formula C6H8O6
and a molecular weight of 176.12 g/mol. Its IUPAC name is (2R)-2-(1,2-dihydroxyethyl)-3,4-dihydroxy-2H-furan-5-one.
Molecular Properties
| Compound Name | (2R)-2-(1,2-dihydroxyethyl)-3,4-dihydroxy-2H-furan-5-one |
| PubChem CID | 54676536 |
| Molecular Formula | C6H8O6 |
| Molecular Weight | 176.12 g/mol |
| Exact Mass | 176.03 |
| IUPAC Name | (2R)-2-(1,2-dihydroxyethyl)-3,4-dihydroxy-2H-furan-5-one |
| SMILES | O=C1O[C@H](C(O)CO)C(O)=C1O |
| InChI | InChI=1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2?,5-/m1/s1 |
| InChIKey | CIWBSHSKHKDKBQ-DOAHDZERSA-N |
| XLogP | -1.41 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.12 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2R)-2-(1,2-dihydroxyethyl)-3,4-dihydroxy-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(1,2-dihydroxyethyl)-3,4-dihydroxy-2H-furan-5-one?
The IUPAC name of (2R)-2-(1,2-dihydroxyethyl)-3,4-dihydroxy-2H-furan-5-one (CID 54676536) is (2R)-2-(1,2-dihydroxyethyl)-3,4-dihydroxy-2H-furan-5-one.
What is the SMILES notation for (2R)-2-(1,2-dihydroxyethyl)-3,4-dihydroxy-2H-furan-5-one?
The canonical SMILES for (2R)-2-(1,2-dihydroxyethyl)-3,4-dihydroxy-2H-furan-5-one is O=C1O[C@H](C(O)CO)C(O)=C1O.
What is the InChIKey of (2R)-2-(1,2-dihydroxyethyl)-3,4-dihydroxy-2H-furan-5-one?
The InChIKey is CIWBSHSKHKDKBQ-DOAHDZERSA-N. The full InChI is InChI=1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2?,5-/m1/s1.
What are the key properties of (2R)-2-(1,2-dihydroxyethyl)-3,4-dihydroxy-2H-furan-5-one?
(2R)-2-(1,2-dihydroxyethyl)-3,4-dihydroxy-2H-furan-5-one has a molecular weight of 176.12 g/mol, XLogP of -1.41, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(1,2-dihydroxyethyl)-3,4-dihydroxy-2H-furan-5-one is sourced from PubChem (CID 54676536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).