C16H20O3 — CID 54676556
6-[(1R,2S,4aR,8aR)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-4-hydroxypyran-2-one (PubChem CID 54676556) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is 6-[(1R,2S,4aR,8aR)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-4-hydroxypyran-2-one.
| Compound Name | 6-[(1R,2S,4aR,8aR)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-4-hydroxypyran-2-one |
|---|---|
| PubChem CID | 54676556 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 6-[(1R,2S,4aR,8aR)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-4-hydroxypyran-2-one |
| SMILES | C[C@H]1C=C[C@H]2CCCC[C@H]2[C@@H]1c1cc(O)cc(=O)o1 |
| InChI | InChI=1S/C16H20O3/c1-10-6-7-11-4-2-3-5-13(11)16(10)14-8-12(17)9-15(18)19-14/h6-11,13,16-17H,2-5H2,1H3/t10-,11+,13+,16+/m0/s1 |
| InChIKey | UNLJRKZPRUHQKX-LRQBHLAOSA-N |
| XLogP | 3.44 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|