C19H19ClN2O6 — CID 54676608
tert-butyl (Z)-2-[(2S,3R)-2-chloro-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidin-1-yl]-3-hydroxybut-2-enoate (PubChem CID 54676608) has the molecular formula C19H19ClN2O6 and a molecular weight of 406.82 g/mol. Its IUPAC name is tert-butyl (Z)-2-[(2S,3R)-2-chloro-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidin-1-yl]-3-hydroxybut-2-enoate.
| Compound Name | tert-butyl (Z)-2-[(2S,3R)-2-chloro-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidin-1-yl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 54676608 |
| Molecular Formula | C19H19ClN2O6 |
| Molecular Weight | 406.82 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | tert-butyl (Z)-2-[(2S,3R)-2-chloro-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidin-1-yl]-3-hydroxybut-2-enoate |
| SMILES | C/C(O)=C(\C(=O)OC(C)(C)C)N1C(=O)[C@@H](N2C(=O)c3ccccc3C2=O)[C@@H]1Cl |
| InChI | InChI=1S/C19H19ClN2O6/c1-9(23)12(18(27)28-19(2,3)4)21-14(20)13(17(21)26)22-15(24)10-7-5-6-8-11(10)16(22)25/h5-8,13-14,23H,1-4H3/b12-9-/t13-,14+/m0/s1 |
| InChIKey | XKLBEGAMAAOIAU-JKOFNFNQSA-N |
| XLogP | 2.19 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.82 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|